CymitQuimica logo

CAS 1245807-93-5

:

Methyl 5-(aminocarbonyl)-1H-pyrazole-1-propanoate

Description:
Methyl 5-(aminocarbonyl)-1H-pyrazole-1-propanoate is a chemical compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features an aminocarbonyl group, indicating the presence of an amine and a carbonyl functional group, which contributes to its reactivity and potential biological activity. The methyl ester functional group enhances its solubility in organic solvents and may influence its pharmacokinetic properties. The propanoate moiety suggests that it has a branched structure, which can affect its steric properties and interactions with biological targets. Methyl 5-(aminocarbonyl)-1H-pyrazole-1-propanoate may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific applications and effects would depend on further studies, including its synthesis, stability, and interactions with other molecules. As with many compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C8H11N3O3
InChI:InChI=1S/C8H11N3O3/c1-14-7(12)3-5-11-6(8(9)13)2-4-10-11/h2,4H,3,5H2,1H3,(H2,9,13)
InChI key:InChIKey=AFPHOXNUBYGMMB-UHFFFAOYSA-N
SMILES:C(CC(OC)=O)N1C(C(N)=O)=CC=N1
Synonyms:
  • 1H-Pyrazole-1-propanoic acid, 5-(aminocarbonyl)-, methyl ester
  • Methyl 5-(aminocarbonyl)-1H-pyrazole-1-propanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.