CAS 1245808-00-7

Benzenemethanamine, 4-fluoro-3-(1-methylethyl)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 4-fluoro-3-(1-methylethyl)-, hydrochloride (1:1), commonly referred to as a substituted phenethylamine, is a chemical compound characterized by its amine functional group and a fluorine atom attached to a benzene ring. The presence of the isopropyl group (1-methylethyl) contributes to its hydrophobic properties, while the hydrochloride form indicates that it is a salt, enhancing its solubility in water. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and pharmacology, due to its potential biological activity. Its structure suggests that it may interact with various biological targets, making it of interest for studies related to neurotransmitter systems. Safety data and handling precautions are essential, as with many amines and their salts, due to potential toxicity and reactivity. As with any chemical, proper laboratory practices should be followed when working with this substance.

Formula: C₁₀H₁₄FN·ClH

InChI: InChI=1S/C10H14FN.ClH/c1-7(2)9-5-8(6-12)3-4-10(9)11;/h3-5,7H,6,12H2,1-2H3;1H

InChI key: InChIKey=ZAKQIRKZERRQFC-UHFFFAOYSA-N

SMILES: C(C)(C)C1=CC(CN)=CC=C1F.Cl

Synonyms:

• Benzenemethanamine, 4-fluoro-3-(1-methylethyl)-, hydrochloride (1:1)