CAS 1245808-13-2

5-[(4-Amino-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-2-thiophenecarboxylic acid

Description:

5-[(4-Amino-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-2-thiophenecarboxylic acid is a chemical compound characterized by its unique structure, which includes a thiophene ring and a pyrazole moiety. The presence of the carboxylic acid functional group contributes to its acidic properties, while the amino group on the pyrazole enhances its potential for hydrogen bonding and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure suggests potential interactions with various biological targets, which could be explored in medicinal chemistry. Additionally, the presence of multiple methyl groups may influence its lipophilicity and solubility, affecting its pharmacokinetic properties. Overall, this compound represents a class of heterocyclic compounds that are often investigated for their diverse applications in drug discovery and development.

Formula: C₁₁H₁₃N₃O₂S

InChI: InChI=1S/C11H13N3O2S/c1-6-10(12)7(2)14(13-6)5-8-3-4-9(17-8)11(15)16/h3-4H,5,12H2,1-2H3,(H,15,16)

InChI key: InChIKey=NOJYTYBMKPSVHQ-UHFFFAOYSA-N

SMILES: C(N1C(C)=C(N)C(C)=N1)C=2SC(C(O)=O)=CC2

Synonyms:

• 2-Thiophenecarboxylic acid, 5-[(4-amino-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-
• 5-[(4-Amino-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-2-thiophenecarboxylic acid

5-[(4-Amino-3,5-dimethyl-1H-pyrazol-1-yl)methyl]thiophene-2-carboxylic acid

CAS: 1245808-13-2

Versatile small molecule scaffold

Formula: C₁₁H₁₃N₃O₂S

Purity: Min. 95%

Molecular weight: 251.31 g/mol

Ref: 3D-VZB80813