CAS 1245808-39-2: 1-Cyclopentyl-3-methyl-1H-pyrazole-5-carboxaldehyde

Description: 1-Cyclopentyl-3-methyl-1H-pyrazole-5-carboxaldehyde is a chemical compound characterized by its unique pyrazole structure, which features a five-membered ring containing two nitrogen atoms. This compound has a cyclopentyl group and a methyl group attached to the pyrazole ring, contributing to its distinct properties. The presence of the aldehyde functional group (-CHO) at the 5-position of the pyrazole ring is significant, as it can participate in various chemical reactions, including condensation and oxidation. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrazole derivatives. Additionally, the compound's solubility and reactivity can be influenced by the substituents on the pyrazole ring, making it a subject of interest for further research in organic synthesis and drug design. Overall, 1-Cyclopentyl-3-methyl-1H-pyrazole-5-carboxaldehyde exemplifies the diverse chemistry of heterocyclic compounds.

Formula: C₁₀H₁₄N₂O

InChI: InChI=1S/C10H14N2O/c1-8-6-10(7-13)12(11-8)9-4-2-3-5-9/h6-7,9H,2-5H2,1H3

InChI key: InChIKey=RJQYBLIWLODOJM-UHFFFAOYSA-N

SMILES: O=CC1=CC(=NN1C2CCCC2)C

1-Cyclopentyl-3-methyl-1H-pyrazole-5-carbaldehyde

CAS: 1245808-39-2

Versatile small molecule scaffold

• Formula: C₁₀H₁₄N₂O
• Purity: Min. 95%
• Molecular weight: 178.23 g/mol

1-cyclopentyl-3-methyl-1H-pyrazole-5-carbaldehyde

CAS: 1245808-39-2

• Molecular weight: 178.23500061035156