CymitQuimica logo

CAS 1245808-40-5

:

1-[(2-Chlorophenyl)methyl]-3-(trifluoromethyl)-1H-pyrazol-5-amine

Description:
1-[(2-Chlorophenyl)methyl]-3-(trifluoromethyl)-1H-pyrazol-5-amine is a chemical compound characterized by its unique structural features, which include a pyrazole ring substituted with a trifluoromethyl group and a chlorophenyl moiety. The presence of the trifluoromethyl group typically enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The chlorophenyl group may also contribute to the compound's reactivity and interaction with biological targets. This compound is likely to exhibit properties such as moderate to high stability under standard conditions, but its reactivity can vary depending on the functional groups present. Additionally, the presence of nitrogen in the pyrazole ring may impart basic characteristics, allowing for potential interactions with various biological systems. Overall, this compound's unique combination of functional groups suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation through experimental studies.
Formula:C11H9ClF3N3
InChI:InChI=1S/C11H9ClF3N3/c12-8-4-2-1-3-7(8)6-18-10(16)5-9(17-18)11(13,14)15/h1-5H,6,16H2
InChI key:InChIKey=GDMIFUTUFACVPB-UHFFFAOYSA-N
SMILES:C(N1N=C(C(F)(F)F)C=C1N)C2=C(Cl)C=CC=C2
Synonyms:
  • 1H-Pyrazol-5-amine, 1-[(2-chlorophenyl)methyl]-3-(trifluoromethyl)-
  • 1-[(2-Chlorophenyl)methyl]-3-(trifluoromethyl)-1H-pyrazol-5-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.