CymitQuimica logo

CAS 1245808-61-0

:

4-Chloro-3-methyl-1-(1-methylpropyl)-1H-pyrazole

Description:
4-Chloro-3-methyl-1-(1-methylpropyl)-1H-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a chloro group at the 4-position and a methyl group at the 3-position contributes to its unique chemical properties. The substituent at the 1-position, specifically a 1-methylpropyl group, adds to its hydrophobic character, influencing its solubility and reactivity. This compound is typically used in various applications, including agrochemicals and pharmaceuticals, due to its potential biological activity. Its molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. The compound's stability and reactivity can be affected by the presence of the chlorine atom, which can participate in nucleophilic substitution reactions. Overall, 4-Chloro-3-methyl-1-(1-methylpropyl)-1H-pyrazole exhibits characteristics typical of substituted pyrazoles, including potential for diverse chemical reactivity and applications in synthetic chemistry.
Formula:C8H13ClN2
InChI:InChI=1S/C8H13ClN2/c1-4-6(2)11-5-8(9)7(3)10-11/h5-6H,4H2,1-3H3
InChI key:InChIKey=ZPDISLLVWJCCPD-UHFFFAOYSA-N
SMILES:C(CC)(C)N1C=C(Cl)C(C)=N1
Synonyms:
  • 4-Chloro-3-methyl-1-(1-methylpropyl)-1H-pyrazole
  • 1H-Pyrazole, 4-chloro-3-methyl-1-(1-methylpropyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.