CAS 1245816-08-3
:2-[2-(Cyclopropylmethoxy)-4,5-difluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Description:
2-[2-(Cyclopropylmethoxy)-4,5-difluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a difluorophenyl moiety. The presence of the cyclopropylmethoxy group contributes to its potential reactivity and solubility properties. This compound is likely to exhibit interesting chemical behavior due to the electron-withdrawing effects of the fluorine atoms, which can influence its reactivity in various chemical reactions, such as nucleophilic substitutions or cross-coupling reactions. The dioxaborolane structure is known for its stability and ability to form complexes with various substrates, making it useful in synthetic organic chemistry. Additionally, the presence of multiple methyl groups enhances its steric bulk, potentially affecting its interactions with other molecules. Overall, this compound may have applications in medicinal chemistry, materials science, or as a reagent in organic synthesis, although specific applications would depend on further research and characterization.
Formula:C16H21BF2O3
InChI:InChI=1S/C16H21BF2O3/c1-15(2)16(3,4)22-17(21-15)11-7-12(18)13(19)8-14(11)20-9-10-5-6-10/h7-8,10H,5-6,9H2,1-4H3
InChI key:InChIKey=TVDPVJZHYPPVSB-UHFFFAOYSA-N
SMILES:O(CC1CC1)C2=C(C=C(F)C(F)=C2)B3OC(C)(C)C(C)(C)O3
Synonyms:- 2-CyclopropylMethoxy-4,5-difluorophenylboronic acid pinacol ester
- 2-[2-(Cyclopropylmethoxy)-4,5-difluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 1,3,2-Dioxaborolane, 2-[2-(cyclopropylmethoxy)-4,5-difluorophenyl]-4,4,5,5-tetramethyl-
- 2-Cyclopropylmethoxy-4,5-difluorophenylboronicacid pinacol ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(2-(Cyclopropylmethoxy)-4,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:Formula:C16H21BF2O3Molecular weight:310.1439
