CymitQuimica logo

CAS 1245822-68-7

:

1,5-Dimethyl-3-(1-piperidinyl)-1H-pyrazol-4-amine

Description:
1,5-Dimethyl-3-(1-piperidinyl)-1H-pyrazol-4-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features two methyl groups at the 1 and 5 positions of the pyrazole ring, contributing to its lipophilicity and potential biological activity. The presence of a piperidine moiety at the 3 position enhances its pharmacological properties, as piperidine is known for its role in various drug interactions and biological functions. The amine functional group at the 4 position can participate in hydrogen bonding, influencing the compound's solubility and reactivity. This substance may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is studied. Overall, 1,5-Dimethyl-3-(1-piperidinyl)-1H-pyrazol-4-amine represents a versatile scaffold for further exploration in pharmaceutical applications.
Formula:C10H18N4
InChI:InChI=1S/C10H18N4/c1-8-9(11)10(12-13(8)2)14-6-4-3-5-7-14/h3-7,11H2,1-2H3
InChI key:InChIKey=XKMBREITSQNTMZ-UHFFFAOYSA-N
SMILES:NC=1C(=NN(C)C1C)N2CCCCC2
Synonyms:
  • 1H-Pyrazol-4-amine, 1,5-dimethyl-3-(1-piperidinyl)-
  • 1,5-Dimethyl-3-(1-piperidinyl)-1H-pyrazol-4-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.