CymitQuimica logo

CAS 1245822-80-3

:

1-Ethyl-5-[(2-nitrophenoxy)methyl]-1H-pyrazole

Description:
1-Ethyl-5-[(2-nitrophenoxy)methyl]-1H-pyrazole is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of an ethyl group at the 1-position and a 2-nitrophenoxy methyl substituent at the 5-position contributes to its unique properties. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic nitrophenyl group, which can influence its solubility and interaction with biological systems. The nitro group may impart specific reactivity, making it a potential candidate for various chemical reactions or applications in medicinal chemistry. Additionally, the pyrazole moiety is known for its biological activity, often being explored for its potential as an anti-inflammatory or analgesic agent. The compound's stability, reactivity, and potential applications would depend on its specific structural features and the presence of functional groups, making it a subject of interest in both synthetic and pharmaceutical chemistry.
Formula:C12H13N3O3
InChI:InChI=1S/C12H13N3O3/c1-2-14-10(7-8-13-14)9-18-12-6-4-3-5-11(12)15(16)17/h3-8H,2,9H2,1H3
InChI key:InChIKey=BHOIUVNQEKPVEP-UHFFFAOYSA-N
SMILES:O(CC=1N(CC)N=CC1)C2=C(N(=O)=O)C=CC=C2
Synonyms:
  • 1-Ethyl-5-[(2-nitrophenoxy)methyl]-1H-pyrazole
  • 1H-Pyrazole, 1-ethyl-5-[(2-nitrophenoxy)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.