CAS 1245823-90-8

3-Amino-4-methyl-1H-pyrazole-1-acetic acid

Description:

3-Amino-4-methyl-1H-pyrazole-1-acetic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its potential as an acid and a base. The presence of the methyl group at the 4-position of the pyrazole ring influences its solubility and reactivity. It is typically a white to off-white solid and is soluble in polar solvents due to its functional groups. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new drugs or agrochemicals. Its CAS number, 1245823-90-8, uniquely identifies it in chemical databases, facilitating research and regulatory processes. As with many pyrazole derivatives, it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, which can be exploited in synthetic organic chemistry.

Formula: C₆H₉N₃O₂

InChI: InChI=1S/C6H9N3O2/c1-4-2-9(3-5(10)11)8-6(4)7/h2H,3H2,1H3,(H2,7,8)(H,10,11)

InChI key: InChIKey=WOBHTGCTMLLZTA-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C=C(C)C(N)=N1

Synonyms:

• 3-Amino-4-methyl-1H-pyrazole-1-acetic acid
• 1H-Pyrazole-1-acetic acid, 3-amino-4-methyl-