CAS 1245823-93-1

4-Chloro-1-(1-methylpropyl)-1H-pyrazole-5-sulfonyl chloride

Description:

4-Chloro-1-(1-methylpropyl)-1H-pyrazole-5-sulfonyl chloride is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a sulfonyl chloride group (-SO2Cl) indicates that it is a sulfonyl chloride derivative, making it a reactive compound often used in organic synthesis. The chlorine atom at the 4-position and the 1-methylpropyl substituent contribute to its unique reactivity and potential applications in medicinal chemistry and agrochemicals. This compound is typically a solid at room temperature and may be sensitive to moisture, requiring careful handling and storage conditions. Its reactivity allows it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in the synthesis of more complex molecules. As with many sulfonyl chlorides, it is important to consider safety precautions due to its potential to release hydrochloric acid upon reaction with water or alcohols.

Formula: C₇H₁₀Cl₂N₂O₂S

InChI: InChI=1S/C7H10Cl2N2O2S/c1-3-5(2)11-7(14(9,12)13)6(8)4-10-11/h4-5H,3H2,1-2H3

InChI key: InChIKey=JKVQVXBDGFVEPA-UHFFFAOYSA-N

SMILES: C(CC)(C)N1C(S(Cl)(=O)=O)=C(Cl)C=N1

Synonyms:

• 4-Chloro-1-(1-methylpropyl)-1H-pyrazole-5-sulfonyl chloride
• 1H-Pyrazole-5-sulfonyl chloride, 4-chloro-1-(1-methylpropyl)-