CAS 1245823-98-6

3-Methoxy-4-(2,2,2-trifluoroethoxy)benzenamine

Description:

3-Methoxy-4-(2,2,2-trifluoroethoxy)benzenamine is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH3) and a trifluoroethoxy group (-O-CF3) attached to a benzene ring. The presence of the methoxy group contributes to its electron-donating properties, enhancing the compound's reactivity in electrophilic aromatic substitution reactions. The trifluoroethoxy group, on the other hand, introduces significant electronegativity due to the three fluorine atoms, which can influence the compound's solubility and polarity. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity may vary depending on the presence of other functional groups or reaction conditions. Additionally, the trifluoroethoxy moiety can impart unique properties such as increased lipophilicity and potential bioactivity, making it of interest in pharmaceutical and agrochemical research. Safety data and handling precautions should be considered due to the presence of fluorinated groups, which can pose environmental and health risks.

Formula: C₉H₁₀F₃NO₂

InChI: InChI=1S/C9H10F3NO2/c1-14-8-4-6(13)2-3-7(8)15-5-9(10,11)12/h2-4H,5,13H2,1H3

InChI key: InChIKey=ZLCPTHMZFLMFSP-UHFFFAOYSA-N

SMILES: O(CC(F)(F)F)C1=C(OC)C=C(N)C=C1

Synonyms:

• 3-Methoxy-4-(2,2,2-trifluoroethoxy)aniline
• Benzenamine, 3-methoxy-4-(2,2,2-trifluoroethoxy)-
• 3-Methoxy-4-(2,2,2-trifluoroethoxy)benzenamine