CAS 1245914-35-5

3-Bromo-5-fluoro-2-(trifluoromethyl)pyridine

Description:

3-Bromo-5-fluoro-2-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of bromine and fluorine substituents at specific positions on the pyridine ring contributes to its unique chemical properties. The trifluoromethyl group (-CF3) is a notable feature, enhancing the compound's lipophilicity and potentially influencing its reactivity and biological activity. This compound is typically used in pharmaceutical research and development due to its potential as a building block for various bioactive molecules. Its molecular structure suggests that it may exhibit interesting electronic properties and reactivity patterns, making it a subject of interest in synthetic organic chemistry. Additionally, the presence of multiple halogen atoms can affect the compound's stability and solubility in different solvents. Overall, 3-Bromo-5-fluoro-2-(trifluoromethyl)pyridine is a versatile compound with applications in medicinal chemistry and materials science.

Formula: C₆H₂BrF₄N

InChI: InChI=1S/C6H2BrF4N/c7-4-1-3(8)2-12-5(4)6(9,10)11/h1-2H

InChI key: InChIKey=RRRFJEMWVAWRIX-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(Br)C=C(F)C=N1

Synonyms:

• 3-Bromo-5-fluoro-2-(trifluoromethyl)pyridine
• Pyridine, 3-bromo-5-fluoro-2-(trifluoromethyl)-