CAS 1245914-99-1

5-(Trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine

Description:

5-(Trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its pyrazolo[3,4-b]pyridine core, which features a fused bicyclic structure containing both pyrazole and pyridine rings. The presence of a trifluoromethyl group (-CF3) at the 5-position significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its reactivity and biological activity. This compound is typically colorless to pale yellow and may exhibit moderate solubility in organic solvents. It is of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. The trifluoromethyl group can also contribute to the compound's stability and metabolic profile. As with many heterocycles, the electronic properties imparted by the nitrogen atoms in the rings can lead to interesting interactions with biological targets, making it a subject of research in pharmacology and material science. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula: C₇H₄F₃N₃

InChI: InChI=1S/C7H4F3N3/c8-7(9,10)5-1-4-2-12-13-6(4)11-3-5/h1-3H,(H,11,12,13)

InChI key: InChIKey=ZIEVSDWECPFMPK-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C2C(=NC1)NN=C2

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine, 5-(trifluoromethyl)-
• 5-(Trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine