CymitQuimica logo

CAS 124596-86-7

:

Gancaonin B

Description:
Gancaonin B is a naturally occurring flavonoid compound, primarily derived from the plant species Gancao, also known as licorice (Glycyrrhiza uralensis). It is characterized by its polyphenolic structure, which contributes to its antioxidant properties. Gancaonin B exhibits a range of biological activities, including anti-inflammatory, antiviral, and potential anticancer effects, making it a subject of interest in pharmacological research. The compound is soluble in organic solvents and has a relatively low solubility in water, which can influence its bioavailability and therapeutic applications. Its mechanism of action often involves modulation of various signaling pathways, enhancing its potential as a therapeutic agent. Additionally, Gancaonin B's safety profile and efficacy are still under investigation, highlighting the need for further studies to fully understand its pharmacokinetics and pharmacodynamics. Overall, Gancaonin B represents a promising candidate for natural product research and development in the field of medicinal chemistry.
Formula:C21H20O6
InChI:InChI=1S/C21H20O6/c1-11(2)4-6-13-15(22)9-18-19(20(13)24)21(25)14(10-27-18)12-5-7-17(26-3)16(23)8-12/h4-5,7-10,22-24H,6H2,1-3H3
InChI key:InChIKey=YQEPOQVRUDADPH-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(O)=C(CC=C(C)C)C2O)OC=C1C3=CC(O)=C(OC)C=C3
Synonyms:
  • 4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-6-(3-methyl-2-butenyl)-
  • 4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-6-(3-methyl-2-buten-1-yl)-
  • Gancaonin B
  • 5,7-Dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-6-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.