
CAS 124596-87-8
:Gancaonin C
Description:
Gancaonin C is a naturally occurring flavonoid compound primarily derived from the plant species Gancao, also known as licorice. It is characterized by its polyphenolic structure, which contributes to its antioxidant properties. This compound exhibits a range of biological activities, including anti-inflammatory, antimicrobial, and potential anticancer effects, making it of interest in pharmacological research. Gancaonin C is soluble in organic solvents and has limited solubility in water, which is typical for many flavonoids. Its stability can be influenced by factors such as pH and light exposure. The compound's mechanism of action often involves modulation of various signaling pathways, which may enhance its therapeutic potential. As with many natural products, further studies are necessary to fully elucidate its pharmacokinetics, bioavailability, and safety profile. Overall, Gancaonin C represents a promising candidate for further investigation in the field of medicinal chemistry and natural product research.
Formula:C20H18O6
InChI:InChI=1S/C20H18O6/c1-11(9-21)2-7-14-16(23)8-17(24)18-19(25)15(10-26-20(14)18)12-3-5-13(22)6-4-12/h2-6,8,10,21-24H,7,9H2,1H3/b11-2+
InChI key:InChIKey=MEADLGUPYQNUNF-BIIKFXOESA-N
SMILES:O=C1C=2C(=C(C/C=C(/CO)\C)C(O)=CC2O)OC=C1C3=CC=C(O)C=C3
Synonyms:- Gancaonin C
- 4H-1-Benzopyran-4-one, 5,7-dihydroxy-8-[(2E)-4-hydroxy-3-methyl-2-butenyl]-3-(4-hydroxyphenyl)-
- 5,7-Dihydroxy-8-[(2E)-4-hydroxy-3-methyl-2-buten-1-yl]-3-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 5,7-dihydroxy-8-[(2E)-4-hydroxy-3-methyl-2-buten-1-yl]-3-(4-hydroxyphenyl)-
- 4H-1-Benzopyran-4-one, 5,7-dihydroxy-8-(4-hydroxy-3-methyl-2-butenyl)-3-(4-hydroxyphenyl)-, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4H-1-Benzopyran-4-one, 5,7-dihydroxy-8-[(2E)-4-hydroxy-3-methyl-2-buten-1-yl]-3-(4-hydroxyphenyl)-
CAS:Formula:C20H18O6Molecular weight:354.3533
