CAS 1246012-25-8: Methyl (1S,4aR,5R,7S,7aS)-7-(acetyloxy)-1-(β-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-4a-hydroxy-7-methyl-5-[[(2E)-1-oxo-3-phenyl-2-propen-1-yl]oxy]cyclopenta[c]pyran-4-carboxylate
Description:The chemical substance with the name "Methyl (1S,4aR,5R,7S,7aS)-7-(acetyloxy)-1-(β-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-4a-hydroxy-7-methyl-5-[[(2E)-1-oxo-3-phenyl-2-propen-1-yl]oxy]cyclopenta[c]pyran-4-carboxylate" and CAS number 1246012-25-8 is a complex organic compound characterized by its intricate stereochemistry and functional groups. It features a hexahydrocyclopenta[c]pyran core, which is modified with various substituents, including an acetyloxy group and a β-D-glucopyranosyloxy moiety. The presence of multiple chiral centers contributes to its stereochemical diversity, influencing its biological activity and potential applications. The compound also contains a phenyl group linked through an enone structure, suggesting potential reactivity and interactions in biological systems. Its structural complexity indicates that it may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Overall, this substance exemplifies the rich diversity of natural product derivatives and their potential utility in various fields, including pharmaceuticals and biochemistry.
Formula:C28H34O14
InChI:InChI=1S/C28H34O14/c1-14(30)42-27(2)11-18(40-19(31)10-9-15-7-5-4-6-8-15)28(36)16(24(35)37-3)13-38-26(23(27)28)41-25-22(34)21(33)20(32)17(12-29)39-25/h4-10,13,17-18,20-23,25-26,29,32-34,36H,11-12H2,1-3H3/b10-9+/t17-,18-,20-,21+,22-,23-,25+,26+,27+,28-/m1/s1
InChI key:InChIKey=IMFOXIVSWVZHOK-WYCHZZGMSA-N
SMILES:O=C(OC1CC(OC(=O)C)(C)C2C(OC=C(C(=O)OC)C12O)OC3OC(CO)C(O)C(O)C3O)C=CC=4C=CC=CC4
- Synonyms:
- 6-O-trans-Cinnamoylphlorigidoside B
- Methyl (1S,4aR,5R,7S,7aS)-7-(acetyloxy)-1-(β-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-4a-hydroxy-7-methyl-5-[[(2E)-1-oxo-3-phenyl-2-propen-1-yl]oxy]cyclopenta[c]pyran-4-carboxylate
- Cyclopenta[c]pyran-4-carboxylic acid, 7-(acetyloxy)-1-(β-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-4a-hydroxy-7-methyl-5-[[(2E)-1-oxo-3-phenyl-2-propen-1-yl]oxy]-, methyl ester, (1S,4aR,5R,7S,7aS)-
![discount label](https://static.cymitquimica.com/public/img/discount.png)
6-O-trans-Cinnamoylphlorigidoside B
Ref: TM-TN3192
1mg | To inquire | ||
5mg | To inquire |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
6-O-trans-Cinnamoylphlorigidoside B
Ref: BP-SBP00863
Undefined size | To inquire |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
6-o-Trans-cinnamoylphlorigidoside B
Ref: 3D-WZB01225
1mg | 461.00 € | ||
5mg | 1,343.00 € | ||
10mg | 2,149.00 € | ||
25mg | 4,028.00 € |