CAS 1246034-50-3

4-[[6-Chloro-2-(methylthio)-4-pyrimidinyl]methyl]morpholine

Description:

4-[[6-Chloro-2-(methylthio)-4-pyrimidinyl]methyl]morpholine, identified by its CAS number 1246034-50-3, is a chemical compound characterized by its unique structural features, which include a pyrimidine ring substituted with a chlorine atom and a methylthio group, as well as a morpholine moiety. This compound typically exhibits properties such as moderate solubility in polar solvents and potential biological activity, making it of interest in pharmaceutical research. The presence of the chlorinated pyrimidine and morpholine suggests that it may interact with biological targets, possibly influencing enzyme activity or receptor binding. Its molecular structure indicates potential for diverse applications, particularly in medicinal chemistry, where it may serve as a lead compound for the development of therapeutics. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, which may affect its synthesis and handling in laboratory settings. Overall, this compound represents a class of heterocyclic compounds that are often explored for their pharmacological properties.

Formula: C₁₀H₁₄ClN₃OS

InChI: InChI=1S/C10H14ClN3OS/c1-16-10-12-8(6-9(11)13-10)7-14-2-4-15-5-3-14/h6H,2-5,7H2,1H3

InChI key: InChIKey=MTCCDUGZDZPSSM-UHFFFAOYSA-N

SMILES: C(C1=NC(SC)=NC(Cl)=C1)N2CCOCC2

Synonyms:

• 4-[[6-Chloro-2-(methylthio)-4-pyrimidinyl]methyl]morpholine
• Morpholine, 4-[[6-chloro-2-(methylthio)-4-pyrimidinyl]methyl]-