CymitQuimica logo

CAS 1246088-41-4

:

5-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid

Description:
5-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a pyrrolopyridine core. The presence of a bromine atom and a phenylsulfonyl group contributes to its unique chemical properties, including potential reactivity and solubility characteristics. This compound typically exhibits moderate to high stability under standard conditions, though it may be sensitive to strong acids or bases. Its carboxylic acid functional group suggests it can participate in acid-base reactions, potentially forming salts or esters. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. Overall, 5-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C14H9BrN2O4S
InChI:InChI=1S/C14H9BrN2O4S/c15-10-6-9-7-12(14(18)19)17(13(9)16-8-10)22(20,21)11-4-2-1-3-5-11/h1-8H,(H,18,19)
InChI key:InChIKey=PJYCZUYUVLBGRU-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C=C1C(O)=O)=CC(Br)=CN2)C3=CC=CC=C3
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid, 5-bromo-1-(phenylsulfonyl)-
  • 5-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.