CymitQuimica logo

CAS 1246088-43-6

:

2,3-Dihydro-1,4-dioxino[2,3-b]pyridin-8-ol

Description:
2,3-Dihydro-1,4-dioxino[2,3-b]pyridin-8-ol is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyridine ring fused with a dioxin moiety. This compound features a hydroxyl group (-OH) at the 8-position of the pyridine ring, contributing to its potential reactivity and solubility in polar solvents. The presence of the dioxin ring imparts distinctive chemical properties, including potential electron-withdrawing characteristics, which can influence its reactivity in various chemical reactions. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. As with many heterocycles, understanding its properties is crucial for exploring its applications in pharmaceuticals, agrochemicals, or materials science.
Formula:C7H7NO3
InChI:InChI=1S/C7H7NO3/c9-5-1-2-8-7-6(5)10-3-4-11-7/h1-2H,3-4H2,(H,8,9)
InChI key:InChIKey=SXRLRBBARNJINI-UHFFFAOYSA-N
SMILES:OC1=C2C(=NC=C1)OCCO2
Synonyms:
  • 3,5-Dihydro-2H-[1,4]dioxino[2,3-b]pyridin-8-one
  • 1,4-Dioxino[2,3-b]pyridin-8-ol, 2,3-dihydro-
  • 2H,3H-[1,4]Dioxino[2,3-b]pyridin-8-ol
  • 2,3-Dihydro-1,4-dioxino[2,3-b]pyridin-8-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.