CAS 1246088-44-7

N-(5-Bromo-2-cyano-3-pyridinyl)-2,2-dimethylpropanamide

Description:

N-(5-Bromo-2-cyano-3-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a bromine atom and a cyano group, along with a branched amide functional group. The presence of the bromine atom enhances its reactivity and potential biological activity, while the cyano group contributes to its electronic properties. The amide linkage indicates that this compound can participate in hydrogen bonding, influencing its solubility and interaction with biological targets. Typically, compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N-(5-Bromo-2-cyano-3-pyridinyl)-2,2-dimethylpropanamide represents a class of compounds that may have significant implications in research and therapeutic contexts.

Formula: C₁₁H₁₂BrN₃O

InChI: InChI=1S/C11H12BrN3O/c1-11(2,3)10(16)15-8-4-7(12)6-14-9(8)5-13/h4,6H,1-3H3,(H,15,16)

InChI key: InChIKey=BKMYOXVZGMRZGW-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)C)=O)C1=C(C#N)N=CC(Br)=C1

Synonyms:

• N-(5-Bromo-2-cyano-3-pyridinyl)-2,2-dimethylpropanamide
• Propanamide, N-(5-bromo-2-cyano-3-pyridinyl)-2,2-dimethyl-