CAS 1246088-46-9

3-Fluoro-5-(3-hydroxy-1-propyn-1-yl)-2-pyridinecarbonitrile

Description:

3-Fluoro-5-(3-hydroxy-1-propyn-1-yl)-2-pyridinecarbonitrile is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a fluorine atom, a cyano group, and a propynyl moiety featuring a hydroxyl group. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity. The hydroxyl group contributes to the compound's potential for hydrogen bonding, which can affect solubility and reactivity. The cyano group is known for its electron-withdrawing properties, which can impact the compound's overall reactivity and stability. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development or as an intermediate in synthetic pathways. Its specific properties, such as melting point, boiling point, and solubility, would require empirical measurement or detailed computational analysis for precise characterization. Overall, the combination of functional groups in this compound suggests a versatile chemical behavior suitable for various applications.

Formula: C₉H₅FN₂O

InChI: InChI=1S/C9H5FN2O/c10-8-4-7(2-1-3-13)6-12-9(8)5-11/h4,6,13H,3H2

InChI key: InChIKey=HPXMDUOFALQRHH-UHFFFAOYSA-N

SMILES: C(#CCO)C=1C=C(F)C(C#N)=NC1

Synonyms:

• 2-Pyridinecarbonitrile, 3-fluoro-5-(3-hydroxy-1-propyn-1-yl)-
• 3-Fluoro-5-(3-hydroxy-1-propyn-1-yl)-2-pyridinecarbonitrile