CAS 1246088-47-0
:2,3-Dihydro-8-[2-(trimethylsilyl)ethynyl]-1,4-dioxino[2,3-b]pyridine
Description:
2,3-Dihydro-8-[2-(trimethylsilyl)ethynyl]-1,4-dioxino[2,3-b]pyridine is a complex organic compound characterized by its unique structural features, including a dioxin ring fused to a pyridine moiety. The presence of the trimethylsilyl group enhances its stability and solubility, making it useful in various chemical applications. This compound typically exhibits properties such as moderate polarity due to the dioxin and pyridine functionalities, which can influence its reactivity and interaction with other molecules. It may also display interesting optical properties, potentially making it suitable for applications in materials science or organic electronics. The ethynyl group contributes to its reactivity, allowing for further functionalization or polymerization. As with many organic compounds, its behavior in different solvents and under varying conditions can significantly affect its stability and reactivity. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage in laboratory or industrial settings.
Formula:C12H15NO2Si
InChI:InChI=1S/C12H15NO2Si/c1-16(2,3)9-5-10-4-6-13-12-11(10)14-7-8-15-12/h4,6H,7-8H2,1-3H3
InChI key:InChIKey=QRNQIECCEMRADU-UHFFFAOYSA-N
SMILES:C(#C[Si](C)(C)C)C1=C2C(=NC=C1)OCCO2
Synonyms:- 1,4-Dioxino[2,3-b]pyridine, 2,3-dihydro-8-[2-(trimethylsilyl)ethynyl]-
- 2,3-Dihydro-8-[2-(trimethylsilyl)ethynyl]-1,4-dioxino[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.