CAS 1246088-50-5
:5-Bromo-2-ethyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
Description:
5-Bromo-2-ethyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrolopyridine core. This compound features a bromine atom at the 5-position and an ethyl group at the 2-position, contributing to its unique reactivity and solubility properties. The presence of a phenylsulfonyl group enhances its potential as a pharmacophore, making it of interest in medicinal chemistry for its possible biological activities. The sulfonyl moiety can improve the compound's interactions with biological targets, potentially influencing its efficacy and selectivity. Additionally, the compound's heterocyclic nature may impart specific electronic properties, affecting its reactivity in various chemical reactions. Its synthesis and characterization typically involve standard organic chemistry techniques, and it may be utilized in research related to drug development or as a building block in organic synthesis. As with many brominated compounds, it may exhibit unique properties such as increased lipophilicity, which can influence its behavior in biological systems.
Formula:C15H13BrN2O2S
InChI:InChI=1S/C15H13BrN2O2S/c1-2-13-9-11-8-12(16)10-17-15(11)18(13)21(19,20)14-6-4-3-5-7-14/h3-10H,2H2,1H3
InChI key:InChIKey=LXKRNOSXVMMUAL-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C=C1CC)=CC(Br)=CN2)C3=CC=CC=C3
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-2-ethyl-1-(phenylsulfonyl)-
- 5-Bromo-2-ethyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.