CAS 1246088-51-6
:2-Ethyl-1H-pyrrolo[2,3-b]pyridine-5-carboxaldehyde
Description:
2-Ethyl-1H-pyrrolo[2,3-b]pyridine-5-carboxaldehyde is a heterocyclic organic compound characterized by its pyrrole and pyridine rings fused together, which contributes to its unique chemical properties. This compound features an aldehyde functional group, which is reactive and can participate in various chemical reactions, such as condensation and oxidation. The presence of the ethyl group enhances its hydrophobic characteristics, influencing its solubility in organic solvents. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrrole and pyridine derivatives. Additionally, the compound may exhibit fluorescence properties, making it of interest in materials science and organic electronics. Its specific reactivity and interactions can be further explored through synthetic modifications or derivatization, which could lead to the discovery of novel compounds with enhanced biological or physical properties. Overall, 2-Ethyl-1H-pyrrolo[2,3-b]pyridine-5-carboxaldehyde represents a versatile scaffold for further chemical exploration.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c1-2-9-4-8-3-7(6-13)5-11-10(8)12-9/h3-6H,2H2,1H3,(H,11,12)
InChI key:InChIKey=RQZRWBCJDGIEKW-UHFFFAOYSA-N
SMILES:C(C)C1=CC=2C(N1)=NC=C(C=O)C2
Synonyms:- 2-Ethyl-1H-pyrrolo[2,3-b]pyridine-5-carboxaldehyde
- 1H-Pyrrolo[2,3-b]pyridine-5-carboxaldehyde, 2-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
