CymitQuimica logo

CAS 1246088-52-7

:

2,3-Dihydro-1,4-dioxino[2,3-b]pyridin-8-amine

Description:
2,3-Dihydro-1,4-dioxino[2,3-b]pyridin-8-amine is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a pyridine and a dioxin moiety. This compound features a dihydro-dioxin ring system fused to a pyridine ring, which contributes to its potential biological activity and chemical reactivity. The presence of an amine functional group at the 8-position of the pyridine ring enhances its solubility in polar solvents and may influence its interactions in biological systems. The compound is likely to exhibit properties typical of nitrogen-containing heterocycles, such as basicity and potential for hydrogen bonding. Its structural complexity suggests that it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Due to its unique structure, 2,3-Dihydro-1,4-dioxino[2,3-b]pyridin-8-amine may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies on its pharmacological properties and safety profile would be necessary to fully understand its potential applications.
Formula:C7H8N2O2
InChI:InChI=1S/C7H8N2O2/c8-5-1-2-9-7-6(5)10-3-4-11-7/h1-2H,3-4H2,(H2,8,9)
InChI key:InChIKey=JTNBYFVUXPHZIJ-UHFFFAOYSA-N
SMILES:NC1=C2C(=NC=C1)OCCO2
Synonyms:
  • 2,3-Dihydro-1,4-dioxino[2,3-b]pyridin-8-amine
  • 1,4-Dioxino[2,3-b]pyridin-8-amine, 2,3-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.