CAS 1246088-55-0

2-Bromo-5-iodo-3-methoxy-4-pyridinol

Description:

2-Bromo-5-iodo-3-methoxy-4-pyridinol is a heterocyclic organic compound characterized by its pyridine ring, which is substituted with a bromine atom at the 2-position, an iodine atom at the 5-position, and a methoxy group at the 3-position. This compound exhibits properties typical of halogenated pyridines, including potential reactivity in nucleophilic substitution reactions due to the presence of the halogen substituents. The methoxy group contributes to its overall polarity and can influence its solubility in various solvents. Additionally, the presence of both bromine and iodine suggests that this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, as halogenated compounds often exhibit enhanced biological activity. The pyridinol moiety may also impart specific pharmacological properties, making it a subject of interest in research related to drug design and synthesis. Overall, 2-Bromo-5-iodo-3-methoxy-4-pyridinol is a complex molecule with potential utility in various chemical and biological applications.

Formula: C₆H₅BrINO₂

InChI: InChI=1S/C6H5BrINO2/c1-11-5-4(10)3(8)2-9-6(5)7/h2H,1H3,(H,9,10)

InChI key: InChIKey=GNJNQRZEUIQCQS-UHFFFAOYSA-N

SMILES: O(C)C=1C(O)=C(I)C=NC1Br

Synonyms:

• 2-Bromo-5-iodo-3-methoxy-4-pyridinol
• 4-Pyridinol, 2-bromo-5-iodo-3-methoxy-