CymitQuimica logo

CAS 1246088-56-1

:

1H-Pyrrolo[2,3-b]pyridine-6-carboxylic acid, 5-fluoro-

Description:
1H-Pyrrolo[2,3-b]pyridine-6-carboxylic acid, 5-fluoro- is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a carboxylic acid functional group enhances its acidity and potential for hydrogen bonding, while the fluorine atom at the 5-position can influence its reactivity and lipophilicity. This compound is of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals. Its structural features may allow for interactions with biological targets, making it a candidate for further research in drug discovery. Additionally, the compound's solubility and stability can be affected by the functional groups present, which is crucial for its application in various chemical and biological contexts. Overall, 1H-Pyrrolo[2,3-b]pyridine-6-carboxylic acid, 5-fluoro- represents a class of compounds that may exhibit significant pharmacological properties, warranting further investigation.
Formula:C8H5FN2O2
InChI:InChI=1S/C8H5FN2O2/c9-5-3-4-1-2-10-7(4)11-6(5)8(12)13/h1-3H,(H,10,11)(H,12,13)
InChI key:InChIKey=ULJRJQSSOOGJAG-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N=C2C(=CC1F)C=CN2
Synonyms:
  • 5-Fluoro-1H-pyrrolo[2,3-b]pyridine-6-carboxylicacid
  • 1H-Pyrrolo[2,3-b]pyridine-6-carboxylic acid, 5-fluoro-
  • 5-Fluoro-7H-pyrrolo[2,3-b]pyridine-6-carboxylic acid
  • 5-Fluoro-7-azaindole-6-carboxylic acid
  • 5-Fluoro-7-azaindole-7-carboxylic acid
  • 5-Fluoro-7-azaindole-6-carboxylic
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.