CymitQuimica logo

CAS 1246088-57-2

:

4-Iodo-1,5-naphthyridin-3-ol

Description:
4-Iodo-1,5-naphthyridin-3-ol is a heterocyclic organic compound characterized by the presence of a naphthyridine ring system, which is a bicyclic structure containing nitrogen atoms. The compound features an iodine substituent at the 4-position and a hydroxyl group (-OH) at the 3-position of the naphthyridine ring. This configuration contributes to its unique chemical properties, including potential reactivity and solubility characteristics influenced by the presence of the iodine atom and the hydroxyl group. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various interactions, including hydrogen bonding due to the hydroxyl group, and it may participate in electrophilic or nucleophilic reactions due to the presence of the iodine atom. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and solvent conditions. Overall, 4-Iodo-1,5-naphthyridin-3-ol represents a valuable compound for further research in organic synthesis and pharmacology.
Formula:C8H5IN2O
InChI:InChI=1S/C8H5IN2O/c9-7-6(12)4-11-5-2-1-3-10-8(5)7/h1-4,12H
InChI key:InChIKey=IIIXVGZRTWCKQJ-UHFFFAOYSA-N
SMILES:IC=1C2=C(N=CC1O)C=CC=N2
Synonyms:
  • 4-Iodo-1,5-naphthyridin-3-ol
  • 1,5-Naphthyridin-3-ol, 4-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.