CAS 1246088-65-2
:2,3-Diiodo-5-methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
Description:
2,3-Diiodo-5-methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is a complex organic compound characterized by its unique structural features, which include a pyrrolopyridine core, iodine substituents, and a phenylsulfonyl group. The presence of iodine atoms typically enhances the compound's reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The methyl group contributes to the compound's hydrophobic character, while the phenylsulfonyl moiety can enhance solubility and stability in various solvents. This compound may exhibit interesting pharmacological properties, potentially acting as a scaffold for drug development. Its synthesis and characterization would involve standard organic chemistry techniques, including halogenation and sulfonylation reactions. Additionally, the compound's properties, such as melting point, solubility, and spectral data (NMR, IR, MS), would be essential for its identification and application in research. Overall, 2,3-Diiodo-5-methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine represents a valuable compound for further investigation in chemical and pharmaceutical contexts.
Formula:C14H10I2N2O2S
InChI:InChI=1S/C14H10I2N2O2S/c1-9-7-11-12(15)13(16)18(14(11)17-8-9)21(19,20)10-5-3-2-4-6-10/h2-8H,1H3
InChI key:InChIKey=FKLZTMYXHYDXTK-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C(I)=C1I)=CC(C)=CN2)C3=CC=CC=C3
Synonyms:- 2,3-Diiodo-5-methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 2,3-diiodo-5-methyl-1-(phenylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,3-Diiodo-5-methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
CAS:Formula:C14H10I2N2O2SMolecular weight:524.1153
