CAS 1246088-68-5
:5-Chloro-6-iodo-1H-pyrrolo[2,3-b]pyridine
Description:
5-Chloro-6-iodo-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its aromaticity and stability. The presence of chlorine and iodine substituents at the 5 and 6 positions, respectively, enhances its reactivity and potential for further chemical modifications. This compound typically exhibits a pale to dark solid appearance and is soluble in organic solvents, reflecting its non-polar characteristics. Its unique structure makes it of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as the halogen atoms can influence biological activity and binding affinity. Additionally, the compound may exhibit specific spectral properties, such as UV-Vis and NMR, which can be utilized for characterization and analysis. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental concerns. Overall, 5-Chloro-6-iodo-1H-pyrrolo[2,3-b]pyridine is a valuable compound in research and development within the field of organic chemistry.
Formula:C7H4ClIN2
InChI:InChI=1S/C7H4ClIN2/c8-5-3-4-1-2-10-7(4)11-6(5)9/h1-3H,(H,10,11)
InChI key:InChIKey=QTYVYZRGDQSFMA-UHFFFAOYSA-N
SMILES:ClC=1C=C2C(=NC1I)NC=C2
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 5-chloro-6-iodo-
- 5-Chloro-6-iodo-1H-pyrrolo[2,3-b]pyridine
- 5-Chloro-6-iodo-7H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.