
CAS 1246172-39-3
:2-Piperidinecarboxamide, N-(3-hydroxypropyl)-, hydrochloride (1:1)
Description:
2-Piperidinecarboxamide, N-(3-hydroxypropyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of the N-(3-hydroxypropyl) substituent indicates that it has a hydroxypropyl chain attached to the nitrogen atom of the piperidine, which may influence its solubility and interaction with biological systems. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for pharmaceutical applications. The compound may exhibit various biological activities, potentially acting as a pharmacological agent, although specific activities would depend on further research. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.
Formula:C9H18N2O2·ClH
InChI:InChI=1S/C9H18N2O2.ClH/c12-7-3-6-11-9(13)8-4-1-2-5-10-8;/h8,10,12H,1-7H2,(H,11,13);1H
InChI key:InChIKey=QCRSFVBBSZPXAR-UHFFFAOYSA-N
SMILES:C(NCCCO)(=O)C1CCCCN1.Cl
Synonyms:- 2-Piperidinecarboxamide, N-(3-hydroxypropyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.