CAS 1246172-41-7

2-Piperidinecarboxamide, N-(4-pyridinylmethyl)-, hydrochloride (1:1)

Description:

2-Piperidinecarboxamide, N-(4-pyridinylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine and pyridine functional groups, which contribute to its potential biological activity. The presence of the piperidine ring provides a cyclic amine structure, while the pyridine moiety enhances its polarity and solubility in polar solvents. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various pharmaceutical applications. This compound may exhibit properties such as being a potential ligand for biological targets, influencing neurotransmitter systems, or serving as a scaffold for drug development. Its molecular structure suggests it could interact with specific receptors or enzymes, which is of interest in medicinal chemistry. Safety and handling precautions are essential, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological profile and therapeutic potential.

Formula: C₁₂H₁₇N₃O·ClH

InChI: InChI=1S/C12H17N3O.ClH/c16-12(11-3-1-2-6-14-11)15-9-10-4-7-13-8-5-10;/h4-5,7-8,11,14H,1-3,6,9H2,(H,15,16);1H

InChI key: InChIKey=YJLIVEMABQAYQA-UHFFFAOYSA-N

SMILES: C(NCC=1C=CN=CC1)(=O)C2CCCCN2.Cl

Synonyms:

• 2-Piperidinecarboxamide, N-(4-pyridinylmethyl)-, hydrochloride (1:1)