CymitQuimica logo

CAS 1246172-46-2

:

Benzenepropanamide, α-amino-N-(2-furanylmethyl)-, hydrochloride (1:1)

Description:
Benzenepropanamide, α-amino-N-(2-furanylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and the presence of a furan ring, which contributes to its unique reactivity and potential biological activity. The compound features a benzene ring attached to a propanamide structure, with an α-amino group that enhances its solubility and interaction with biological systems. The hydrochloride form indicates that it is a salt, which typically improves stability and solubility in aqueous solutions. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components. Its specific interactions, such as binding affinity to biological targets or metabolic pathways, would require further investigation through experimental studies. As with many compounds containing furan, caution is advised due to potential toxicity or reactivity under certain conditions. Overall, Benzenepropanamide, α-amino-N-(2-furanylmethyl)-, hydrochloride (1:1) represents a complex structure with potential applications in various fields, including drug development and organic synthesis.
Formula:C14H16N2O2·ClH
InChI:InChI=1S/C14H16N2O2.ClH/c15-13(9-11-5-2-1-3-6-11)14(17)16-10-12-7-4-8-18-12;/h1-8,13H,9-10,15H2,(H,16,17);1H
InChI key:InChIKey=IRYBBPQIZLGNIY-UHFFFAOYSA-N
SMILES:C(C(C(NCC1=CC=CO1)=O)N)C2=CC=CC=C2.Cl
Synonyms:
  • Benzenepropanamide, α-amino-N-(2-furanylmethyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.