CymitQuimica logo

CAS 1246172-53-1

:

Benzenepropanamide, α-amino-N-(2-pyridinylmethyl)-, hydrochloride (1:1)

Description:
Benzenepropanamide, α-amino-N-(2-pyridinylmethyl)-, hydrochloride (1:1), identified by its CAS number 1246172-53-1, is a chemical compound characterized by its amide functional group and the presence of a pyridine ring. This compound typically exhibits properties associated with both aromatic and aliphatic structures, contributing to its stability and reactivity. The hydrochloride form indicates that it is a salt, which often enhances its solubility in water and may influence its biological activity. The α-amino group suggests that it may participate in various biochemical interactions, potentially acting as an amino acid derivative. This compound may be of interest in pharmaceutical research due to its structural features, which could be relevant in the development of drugs targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its applications could range from medicinal chemistry to materials science, depending on its specific properties and interactions.
Formula:C15H17N3O·ClH
InChI:InChI=1S/C15H17N3O.ClH/c16-14(10-12-6-2-1-3-7-12)15(19)18-11-13-8-4-5-9-17-13;/h1-9,14H,10-11,16H2,(H,18,19);1H
InChI key:InChIKey=SHWNGDMUKKAOJZ-UHFFFAOYSA-N
SMILES:C(C(C(NCC1=CC=CC=N1)=O)N)C2=CC=CC=C2.Cl
Synonyms:
  • Benzenepropanamide, α-amino-N-(2-pyridinylmethyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.