CAS 1246172-59-7

2-Piperidinecarboxamide, N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1)

Description:

2-Piperidinecarboxamide, N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine and tetrahydropyran moieties, which contribute to its structural complexity and potential biological activity. The presence of the piperidine ring suggests that it may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. The N-methyl substitution indicates that the compound may have altered steric and electronic properties compared to its non-methylated counterparts. As a hydrochloride salt, it is likely to be more soluble in water, enhancing its bioavailability for pharmaceutical applications. This compound may be of interest in medicinal chemistry, particularly in the development of therapeutics targeting neurological or psychiatric conditions, given the structural features common in drug design. However, specific pharmacological properties, toxicity, and safety profiles would require further investigation through experimental studies and literature review.

Formula: C₁₃H₂₄N₂O₂·ClH

InChI: InChI=1S/C13H24N2O2.ClH/c1-15(10-11-5-8-17-9-6-11)13(16)12-4-2-3-7-14-12;/h11-12,14H,2-10H2,1H3;1H

InChI key: InChIKey=HPPAZFIXYDTGDW-UHFFFAOYSA-N

SMILES: C(N(CC1CCOCC1)C)(=O)C2CCCCN2.Cl

Synonyms:

• 2-Piperidinecarboxamide, N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1)