
CAS 1246172-61-1
:Propanamide, 2-amino-N-(3-ethoxypropyl)-, hydrochloride (1:1)
Description:
Propanamide, 2-amino-N-(3-ethoxypropyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential applications in pharmaceuticals and biochemistry. The presence of the amino group suggests that it may exhibit basic properties, while the ethoxypropyl side chain can influence its solubility and hydrophobicity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its bioavailability for potential therapeutic uses. The compound's structure suggests it may participate in hydrogen bonding, which can affect its interactions with biological targets. Additionally, the specific arrangement of functional groups may impart unique pharmacological properties, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties, including stability, reactivity, and potential applications in drug development or other fields.
Formula:C8H18N2O2·ClH
InChI:InChI=1S/C8H18N2O2.ClH/c1-3-12-6-4-5-10-8(11)7(2)9;/h7H,3-6,9H2,1-2H3,(H,10,11);1H
InChI key:InChIKey=CSTPJKHDZUAMHA-UHFFFAOYSA-N
SMILES:N(C(C(C)N)=O)CCCOCC.Cl
Synonyms:- Propanamide, 2-amino-N-(3-ethoxypropyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.