
CAS 1246172-68-8
:Benzenepropanamide, α-amino-N-(1-methylpropyl)-, hydrochloride (1:1)
Description:
Benzenepropanamide, α-amino-N-(1-methylpropyl)-, hydrochloride (1:1), with the CAS number 1246172-68-8, is a chemical compound characterized by its amide functional group and an amino group attached to a propanamide structure. This compound features a benzene ring, which contributes to its aromatic properties, and a branched alkyl chain (1-methylpropyl) that influences its solubility and interaction with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The presence of the amino group suggests potential basicity, while the amide linkage indicates stability and the ability to participate in hydrogen bonding. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific properties, such as melting point, solubility, and reactivity, would depend on the conditions and the presence of other substances in the environment.
Formula:C13H20N2O·ClH
InChI:InChI=1S/C13H20N2O.ClH/c1-3-10(2)15-13(16)12(14)9-11-7-5-4-6-8-11;/h4-8,10,12H,3,9,14H2,1-2H3,(H,15,16);1H
InChI key:InChIKey=MNPOTLKQYCQHJY-UHFFFAOYSA-N
SMILES:C(C(C(NC(CC)C)=O)N)C1=CC=CC=C1.Cl
Synonyms:- Benzenepropanamide, α-amino-N-(1-methylpropyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.