CAS 1246172-70-2

Benzenepropanamide, α-amino-N-cyclopentyl-, hydrochloride (1:1)

Description:

Benzenepropanamide, α-amino-N-cyclopentyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from benzene and propanamide structures. This compound features a cyclopentyl group attached to the nitrogen atom of the amide, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in pharmaceutical formulations. The presence of the amino group indicates that it may exhibit basic properties, which can influence its interaction with biological systems. The compound's structure suggests potential uses in medicinal chemistry, particularly in the development of drugs targeting specific receptors or enzymes. Additionally, its molecular characteristics may impart specific pharmacokinetic and pharmacodynamic properties, making it a candidate for further research in therapeutic applications. As with many amides, it may also exhibit stability under various conditions, although specific reactivity and stability would depend on the surrounding environment and conditions.

Formula: C₁₄H₂₀N₂O·ClH

InChI: InChI=1S/C14H20N2O.ClH/c15-13(10-11-6-2-1-3-7-11)14(17)16-12-8-4-5-9-12;/h1-3,6-7,12-13H,4-5,8-10,15H2,(H,16,17);1H

InChI key: InChIKey=GNKGISJIQZOLFS-UHFFFAOYSA-N

SMILES: C(C(C(NC1CCCC1)=O)N)C2=CC=CC=C2.Cl

Synonyms:

• Benzenepropanamide, α-amino-N-cyclopentyl-, hydrochloride (1:1)