
CAS 1246172-74-6
:Benzenepropanamide, α-amino-N-(4-methoxyphenyl)-, hydrochloride (1:1)
Description:
Benzenepropanamide, α-amino-N-(4-methoxyphenyl)-, hydrochloride (1:1), with the CAS number 1246172-74-6, is a chemical compound characterized by its amide functional group and an amino group attached to a benzene ring. This compound features a methoxy substituent on the phenyl ring, which can influence its solubility and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological and pharmaceutical applications. The presence of both the amine and the amide functional groups suggests potential for hydrogen bonding, which may affect its interaction with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with various biological pathways. Additionally, the methoxy group may contribute to its lipophilicity, influencing its pharmacokinetic profile. Overall, this compound's unique structure positions it as a candidate for further research in drug development and related fields.
Formula:C16H18N2O2·ClH
InChI:InChI=1S/C16H18N2O2.ClH/c1-20-14-9-7-13(8-10-14)18-16(19)15(17)11-12-5-3-2-4-6-12;/h2-10,15H,11,17H2,1H3,(H,18,19);1H
InChI key:InChIKey=GOGGSQKYOCTTMB-UHFFFAOYSA-N
SMILES:N(C(C(CC1=CC=CC=C1)N)=O)C2=CC=C(OC)C=C2.Cl
Synonyms:- Benzenepropanamide, α-amino-N-(4-methoxyphenyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.