
CAS 1246172-77-9
:1-Propanone, 2-amino-1-(4-methyl-1-piperidinyl)-3-phenyl-, hydrochloride (1:1)
Description:
1-Propanone, 2-amino-1-(4-methyl-1-piperidinyl)-3-phenyl-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its amine and ketone functional groups. It features a piperidine ring, which contributes to its potential biological activity, particularly in pharmacological contexts. The presence of the phenyl group enhances its lipophilicity, potentially influencing its ability to cross biological membranes. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for formulation in pharmaceutical applications. The compound may exhibit various properties such as stability under specific conditions, and its interactions with biological systems can be significant, making it of interest in medicinal chemistry. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound's unique structure suggests potential utility in therapeutic applications, although specific biological activities would require further investigation.
Formula:C15H22N2O·ClH
InChI:InChI=1S/C15H22N2O.ClH/c1-12-7-9-17(10-8-12)15(18)14(16)11-13-5-3-2-4-6-13;/h2-6,12,14H,7-11,16H2,1H3;1H
InChI key:InChIKey=LOYSYJHMNZGMJR-UHFFFAOYSA-N
SMILES:C(C(CC1=CC=CC=C1)N)(=O)N2CCC(C)CC2.Cl
Synonyms:- 1-Propanone, 2-amino-1-(4-methyl-1-piperidinyl)-3-phenyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.