CymitQuimica logo

CAS 1246172-79-1

:

2-Piperidinecarboxamide, N-(1-methylpropyl)-, hydrochloride (1:1)

Description:
2-Piperidinecarboxamide, N-(1-methylpropyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a carboxamide functional group, contributing to its potential as a pharmacological agent. The presence of the N-(1-methylpropyl) substituent indicates that it has an alkyl chain attached to the nitrogen atom, which can influence its solubility and biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including in medicinal chemistry. The compound may exhibit properties such as being a potential ligand for biological targets, and its pharmacokinetic profile would be influenced by the piperidine structure and the substituents present. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its biological activity and potential therapeutic applications.
Formula:C10H20N2O·ClH
InChI:InChI=1S/C10H20N2O.ClH/c1-3-8(2)12-10(13)9-6-4-5-7-11-9;/h8-9,11H,3-7H2,1-2H3,(H,12,13);1H
InChI key:InChIKey=IWDPNDVZWVLODV-UHFFFAOYSA-N
SMILES:C(NC(CC)C)(=O)C1CCCCN1.Cl
Synonyms:
  • 2-Piperidinecarboxamide, N-(1-methylpropyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.