CymitQuimica logo

CAS 1246172-89-3

:

Benzenepropanamide, α-amino-N-[2-(dimethylamino)ethyl]-, hydrochloride (1:2)

Description:
Benzenepropanamide, α-amino-N-[2-(dimethylamino)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its amide functional group and a benzene ring, which contributes to its aromatic properties. The presence of the dimethylamino group indicates that it has basic characteristics, potentially allowing it to interact with various biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability. This compound may exhibit pharmacological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structure suggests potential interactions with neurotransmitter systems, possibly influencing mood or cognitive functions. Safety and handling precautions are essential, as with many amine-containing compounds, due to potential toxicity or irritant properties. Overall, the compound's unique structure and properties make it a subject of interest for further research in both synthetic and medicinal chemistry.
Formula:C13H21N3O·2ClH
InChI:InChI=1S/C13H21N3O.2ClH/c1-16(2)9-8-15-13(17)12(14)10-11-6-4-3-5-7-11;;/h3-7,12H,8-10,14H2,1-2H3,(H,15,17);2*1H
InChI key:InChIKey=JIWOGZDOLSRFNJ-UHFFFAOYSA-N
SMILES:C(C(C(NCCN(C)C)=O)N)C1=CC=CC=C1.Cl
Synonyms:
  • Benzenepropanamide, α-amino-N-[2-(dimethylamino)ethyl]-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.