
CAS 124620-88-8
:2′-Methylspiro[1-azabicyclo[2.2.2]octane-3,5′-[1,3]oxathiolane]
Description:
2′-Methylspiro[1-azabicyclo[2.2.2]octane-3,5′-[1,3]oxathiolane] is a chemical compound characterized by its unique spirocyclic structure, which combines a bicyclic amine and a thioether moiety. The presence of the azabicyclo[2.2.2]octane framework contributes to its rigidity and potential biological activity, while the oxathiolane ring introduces sulfur into the structure, which can influence its reactivity and interaction with biological targets. This compound may exhibit properties typical of spiro compounds, such as conformational flexibility and the ability to engage in various intermolecular interactions. Its methyl substitution at the 2′ position can affect its lipophilicity and overall pharmacokinetic profile. The compound's specific applications and biological activities would depend on its interaction with various receptors or enzymes, making it of interest in medicinal chemistry and drug development. As with many such compounds, further studies would be necessary to elucidate its full range of properties and potential uses.
Formula:C10H17NOS
InChI:InChI=1S/C10H17NOS/c1-8-12-10(7-13-8)6-11-4-2-9(10)3-5-11/h8-9H,2-7H2,1H3
InChI key:InChIKey=WUTYZMFRCNBCHQ-UHFFFAOYSA-N
SMILES:CC1OC2(C3CCN(C2)CC3)CS1
Synonyms:- 2′-Methylspiro[1-azabicyclo[2.2.2]octane-3,5′-[1,3]oxathiolane]
- 2-Methylspiro[1,3-oxathiolane-5,3′-1-azabicyclo[2.2.2]octane]
- Spiro[1-azabicyclo[2.2.2]octane-3,5′-[1,3]oxathiolane], 2′-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Spiro[1-azabicyclo[2.2.2]octane-3,5'-[1,3]oxathiolane], 2'-methyl-
CAS:Formula:C10H17NOSMolecular weight:199.3131
