CymitQuimica logo

CAS 1246210-07-0

:

1,1-Dimethylethyl 6-fluoro-3,4-dihydro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2(1H)-isoquinolinecarboxylate

Description:
1,1-Dimethylethyl 6-fluoro-3,4-dihydro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2(1H)-isoquinolinecarboxylate is a complex organic compound characterized by its unique structural features, including a fluorine atom and a dioxaborolane moiety. The presence of the isoquinoline framework suggests potential biological activity, as isoquinolines are often found in various natural products and pharmaceuticals. The compound's dioxaborolane group may enhance its stability and solubility, making it suitable for applications in medicinal chemistry or materials science. Additionally, the tert-butyl group contributes to steric hindrance, which can influence the compound's reactivity and interaction with biological targets. Its specific properties, such as melting point, boiling point, solubility, and spectral characteristics, would typically be determined through experimental methods. Overall, this compound represents a class of molecules that may have significant implications in drug development and synthetic chemistry.
Formula:C20H29BFNO4
InChI:InChI=1S/C20H29BFNO4/c1-18(2,3)25-17(24)23-9-8-13-11-16(22)15(10-14(13)12-23)21-26-19(4,5)20(6,7)27-21/h10-11H,8-9,12H2,1-7H3
InChI key:InChIKey=OYMMTUNJPXPGLY-UHFFFAOYSA-N
SMILES:FC1=C(B2OC(C)(C)C(C)(C)O2)C=C3C(=C1)CCN(C(OC(C)(C)C)=O)C3
Synonyms:
  • 1,1-Dimethylethyl 6-fluoro-3,4-dihydro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2(1H)-isoquinolinecarboxylate
  • 2(1H)-Isoquinolinecarboxylic acid, 6-fluoro-3,4-dihydro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.