CymitQuimica logo

CAS 124623-15-0

:

1-(2-Amino-5-bromophenyl)-1-propanone

Description:
1-(2-Amino-5-bromophenyl)-1-propanone, identified by its CAS number 124623-15-0, is an organic compound characterized by the presence of a propanone moiety attached to a substituted aniline structure. This compound features a bromine atom and an amino group on the aromatic ring, which can influence its reactivity and solubility. The amino group typically imparts basic properties, while the bromine atom can serve as a site for further chemical modifications, such as nucleophilic substitution reactions. The presence of the ketone functional group (propanone) suggests potential reactivity in condensation reactions or as a precursor in synthetic pathways. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, 1-(2-Amino-5-bromophenyl)-1-propanone is a versatile compound with potential applications in various chemical and pharmaceutical contexts.
Formula:C9H10BrNO
InChI:InChI=1S/C9H10BrNO/c1-2-9(12)7-5-6(10)3-4-8(7)11/h3-5H,2,11H2,1H3
InChI key:InChIKey=QGGYMYVVGFZOCT-UHFFFAOYSA-N
SMILES:C(CC)(=O)C1=C(N)C=CC(Br)=C1
Synonyms:
  • 1-(2-Amino-5-bromophenyl)-1-propanone
  • 2-Amino-5-bromopropiophenone
  • 1-Propanone, 1-(2-amino-5-bromophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.