CAS 124627-86-7
:1-[[2-(2,4-Difluorophenyl)-3-methyl-2-oxiranyl]methyl]-1H-1,2,4-triazole
Description:
1-[[2-(2,4-Difluorophenyl)-3-methyl-2-oxiranyl]methyl]-1H-1,2,4-triazole is a chemical compound characterized by its unique structure, which includes a triazole ring and an epoxide moiety. The presence of the difluorophenyl group contributes to its potential biological activity, making it of interest in pharmaceutical research. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential reactivity due to the epoxide group, which can participate in nucleophilic addition reactions. The triazole ring is known for its stability and ability to form hydrogen bonds, which can influence its interactions with biological targets. Additionally, the compound may possess antifungal or antimicrobial properties, as many triazole derivatives are utilized in these applications. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound represents a class of chemicals that are valuable in medicinal chemistry and agrochemical applications.
Formula:C12H11F2N3O
InChI:InChI=1S/C12H11F2N3O/c1-8-12(18-8,5-17-7-15-6-16-17)10-3-2-9(13)4-11(10)14/h2-4,6-8H,5H2,1H3
InChI key:InChIKey=QANJLSHZDUOBBP-UHFFFAOYSA-N
SMILES:C(C1(C(C)O1)C2=C(F)C=C(F)C=C2)N3C=NC=N3
Synonyms:- 1H-1,2,4-Triazole, 1-[[2-(2,4-difluorophenyl)-3-methyloxiranyl]methyl]-
- 1-[[2-(2,4-Difluorophenyl)-3-methyl-2-oxiranyl]methyl]-1H-1,2,4-triazole
- 1H-1,2,4-Triazole, 1-[[2-(2,4-difluorophenyl)-3-methyl-2-oxiranyl]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.