CAS 1246308-83-7

7H-Benzofuro[2,3-b]carbazole

Description:

7H-Benzofuro[2,3-b]carbazole is a polycyclic aromatic compound characterized by its fused benzofuro and carbazole structures. This compound typically exhibits a planar configuration, which contributes to its potential electronic properties, making it of interest in organic electronics and materials science. It is generally insoluble in water but may dissolve in organic solvents, reflecting its hydrophobic nature. The presence of multiple aromatic rings often leads to significant π-π stacking interactions, which can influence its behavior in solid-state applications. Additionally, compounds of this type may exhibit interesting photophysical properties, such as fluorescence or phosphorescence, depending on their molecular structure and environment. The compound's stability and reactivity can be influenced by substituents on the aromatic rings, which can modulate its electronic properties and potential applications in fields like organic light-emitting diodes (OLEDs) or organic photovoltaics (OPVs). Overall, 7H-Benzofuro[2,3-b]carbazole represents a class of compounds with promising applications in advanced materials and electronic devices.

Formula: C₁₈H₁₁NO

InChI: InChI=1S/C18H11NO/c1-3-7-15-11(5-1)13-9-14-12-6-2-4-8-17(12)20-18(14)10-16(13)19-15/h1-10,19H

InChI key: InChIKey=ISBQNNXMWRWLNW-UHFFFAOYSA-N

SMILES: C1=2C=3C(NC1=CC4=C(C2)C=5C(O4)=CC=CC5)=CC=CC3

Synonyms:

• 7H-Benzofuro[2,3-b]carbazole

7H-benzofuro[2,3-b]carbazole

CAS: 1246308-83-7

7H-benzofuro[2,3-b]carbazole

Purity: 98%

Molecular weight: 257.29g/mol

Ref: 54-OR1001285