CAS 124646-10-2
:3-{[(2-carbamimidamido-1,3-thiazol-4-yl)methyl]sulfanyl}propanimidamide
Description:
3-{[(2-carbamimidamido-1,3-thiazol-4-yl)methyl]sulfanyl}propanimidamide, with the CAS number 124646-10-2, is a chemical compound characterized by its complex structure that includes a thiazole ring and a sulfanyl group. This compound features a propanimidamide backbone, which contributes to its potential biological activity. The presence of the thiazole moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The sulfanyl group may enhance its reactivity and solubility, influencing its pharmacokinetic properties. Additionally, the carbamimidamido functional groups indicate potential for hydrogen bonding and interactions with enzymes or receptors. Overall, this compound's unique structural features may contribute to its efficacy in various applications, particularly in the development of therapeutic agents. However, detailed studies on its biological activity, stability, and synthesis are necessary to fully understand its potential uses and mechanisms of action.
Formula:C8H14N6S2
InChI:InChI=1/C8H14N6S2/c9-6(10)1-2-15-3-5-4-16-8(13-5)14-7(11)12/h4H,1-3H2,(H3,9,10)(H4,11,12,13,14)
SMILES:C(CSCc1csc(n1)NC(=N)N)C(=N)N
Synonyms:- Propanimidamide, 3-[[[2-[(aminoiminomethyl)amino]-4-thiazolyl]methyl]thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
