CymitQuimica logo

CAS 1246466-57-8

:

5-Fluoro-2-pyrazinecarbonitrile

Description:
5-Fluoro-2-pyrazinecarbonitrile is a heterocyclic organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at non-adjacent positions. The compound features a fluorine atom substituted at the 5-position of the pyrazine ring and a cyano group (-C≡N) at the 2-position, contributing to its chemical reactivity and potential applications in various fields. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of both the fluorine and cyano groups enhances its electronic properties, making it of interest in medicinal chemistry and material science. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the electrophilic nature of the cyano group. Its unique structure and functional groups make it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H2FN3
InChI:InChI=1S/C5H2FN3/c6-5-3-8-4(1-7)2-9-5/h2-3H
InChI key:InChIKey=ZABZAXZUTUSDGA-UHFFFAOYSA-N
SMILES:C(#N)C=1C=NC(F)=CN1
Synonyms:
  • 5-Fluoro-2-pyrazinecarbonitrile
  • 2-Pyrazinecarbonitrile, 5-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.